hehe199 hehe199

03-06-2022
English

contestada

Which of the following sentences has a Nonessential clause?

Which of the following sentences has a Nonessential clause class=

Respuesta :

lilyjames76 lilyjames76

03-06-2022

Answer:

Explanation:

sentence b I took the test

Answer Link

faithuanseoje17 faithuanseoje17

03-06-2022

Answer:

sentence b

Explanation:

sentence b is the answer

Answer Link

Otras preguntas

HELP ME PLZZZZZ Which of the following objectives was not a goal of the nations at the conferences at Yalta and Potsdam? 1Great Britain wanted to create democ

Which statement correctly describes a chemical reaction? a.Reactants come out of a reaction. b.Energy is always released. c.Bonds between atoms break and new bo

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

The electron configuration for Helium (He) is shown below. 1s2 Which diagram shows the correct distribution of electrons in the electron shells of

PLEASE HELP How does the movement of molecules inside a solid block of iron change as the iron is heated? (2 points) The molecules move faster. The molecules mo

Examine the expanded form. a ∙ a ∙ a ∙ a ∙ a ∙ a ∙ a Which is the expression in exponential form?

The scientific notation 2.15 x 10 ^-3 has what value? 0.0002150.002152152,150

Who is Ben ki moon, in the film before the flood

Please help: What are the Amplitude, Period, Midline, and Phase Shift for f(x) = -5 cos(3x - pi) + 2

The frequency of a radio wave varies inversely with its wavelength. If a 100-meter wave has a frequency of 3,000 kilohertz, what is the wavelength of a wave tha