adelo77 adelo77
  • 03-11-2019
  • Mathematics
contestada

cosec(6b+pi/8)=sec(2b-pi/8)​

Respuesta :

2002hemal
2002hemal 2002hemal
  • 03-11-2019

Step-by-step explanation:

cosec( 6b+ pie/8)=sec(2b-pie/8)

1/ sin( 6b +pie/8)=1/sec(2b-pie/8)

cos(2b-pie/8)=sin(6b-pie/8)

cosX =sin(pie/2-x)

sin(pie/2-2b+pie/8)=sin(6b+pie/8)

pie/2-2b+pie/8=6b+pie/8

pie/2=8b

b = pie/16

Ver imagen 2002hemal
Answer Link

Otras preguntas

Which word in the sentence is the predicate nominative? At the fair, the turtle races have become an annual event. A. event B. annual C. races D. fair
if evaporation cools the surrounding does condensation warm the surroundings ? explain
Find the sum 1/b^2c +b/c^2
A researcher is designing a laboratory experiment to determine whether the inorganic substance A affects the rate of a reaction between two colored liquids, X a
what is 10 more than 56
whenever i sit down to eat dinner,the phone rings. complex sentence
2(4 + 2x) ≥ 5x + 5? please help
What's 0.46% of 80 equal to ?
Which process involves the removal of rock particles by wind water ice or gravity?
what decimal is equivalent to 500 thousandths and 8 hundredths?