esmeraldavelez63 esmeraldavelez63
  • 01-02-2019
  • Geography
contestada

To be eligible for naturalization, an immigrant must be able to speak, read, write, and understand:
A) His Name
B) Poetry
C) The Constitution
D) The English Language

Respuesta :

lexybellx3
lexybellx3 lexybellx3
  • 01-02-2019
C the constitution because it is where we get our fundamental laws and our national government from
Answer Link

Otras preguntas

how did Charles Wallace speak when he first learn to talk​
cosec(6b+pi/8)=sec(2b-pi/8)​
The causes of frictional unemployment include: A. labor unions. B. changes of economic structure. C. the scarcity of information. D. the business cycle.
a furniture shop refinshes cabinets. employees use one of two methods to refinish each cabinet. method 1 takes 1 hour and the material costs $6. method 2 takes
0.75(8+e)=2-1.25e Solve for e
A small accounting firm has 444 accountants who each earn a different salary between \$50{,}000$50,000dollar sign, 50, comma, 000 and \$60{,}000$60,000dollar si
Write a loop to print the numbers: 11, 21,...51 using Python
explain the importance of the ECM and its involvement in cellular communication​
what is the mass of a proton equal to
What is the lower class limit of the class 13–17?